A8457412
Z-L-Methionine , 98% , 1152-62-1
Synonym(s):
N-Carbobenzyloxy-L -methionine;Z-Met-OH
CAS NO.:1152-62-1
Empirical Formula: C13H17NO4S
Molecular Weight: 283.34
MDL number: MFCD00065124
EINECS: 214-570-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB69.60 | In Stock |
|
| 25G | RMB216.00 | In Stock |
|
| 100G | RMB630.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-69 °C |
| alpha | -18.5 º (c=2.4 in 95% EtOH) |
| Boiling point: | 504.7±50.0 °C(Predicted) |
| Density | 1.253±0.06 g/cm3(Predicted) |
| refractive index | -26 ° (C=1, MeOH) |
| storage temp. | 2-8°C |
| solubility | almost transparency in Methanol |
| form | Powder or Crystalline Powder |
| pka | 3.81±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]25/D 18.5°, c = 2.4 in 95% ethanol |
| BRN | 2058696 |
| Major Application | peptide synthesis |
| InChI | 1S/C13H17NO4S/c1-19-8-7-11(12(15)16)14-13(17)18-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,14,17)(H,15,16)/t11-/m0/s1 |
| InChIKey | FPKHNNQXKZMOJJ-LLVKDONJSA-N |
| SMILES | CSCC[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 1152-62-1(CAS DataBase Reference) |
Description and Uses
N-Cbz-L-methionine is a protected form of L-Methionine (M260440). L-Methionine is an essential amino acid that is obtained from our diet. L-Methionine can be found in grain legumes (such as lentils), and poultry. L-Methionine’s main function is to act as the primary “Start” sequence on mRNA so that the ribosomes can start translating the mRNA into proteins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







