PRODUCT Properties
| Melting point: | 105-107 °C(lit.) |
| Boiling point: | 352.3±37.0 °C(Predicted) |
| Density | 1.729±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| form | powder, crystals or chunks |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C6H2Cl2N2O4/c7-3-1-5(9(11)12)6(10(13)14)2-4(3)8/h1-2H |
| InChIKey | IGSAVPVCQHAPSM-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(Cl)c(Cl)cc1[N+]([O-])=O |
Description and Uses
1,2-Dichloro-4,5-dinitrobenzene is a dye/stain. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CZ4900000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
