A8511632
Metconazole , Analysis standard , 125116-23-6
Synonym(s):
5-(4-Chlorophenylmethyl)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol
CAS NO.:125116-23-6
Empirical Formula: C17H22ClN3O
Molecular Weight: 319.83
MDL number: MFCD01632341
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB743.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111.5°C |
| Boiling point: | 285°C (rough estimate) |
| Density | 1.1888 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| pka | 13.82±0.60(Predicted) |
| BRN | 8333708 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C17H22ClN3O/c1-16(2)8-7-14(9-13-3-5-15(18)6-4-13)17(16,22)10-21-12-19-11-20-21/h3-6,11-12,14,22H,7-10H2,1-2H3 |
| InChIKey | XWPZUHJBOLQNMN-UHFFFAOYSA-N |
| SMILES | C1(CN2C=NC=N2)(O)C(CC2=CC=C(Cl)C=C2)CCC1(C)C |
| EPA Substance Registry System | Metconazole (125116-23-6) |
Description and Uses
Metconazole is an conazole based fungicide used for the control of black sigatoka disease on banana. Metconazole acts primarily as an inhibitor of ergosterol biosynthesis which interferes with the syn thesis of fungal cell membranes.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H361d-H411 |
| Precautionary statements | P201-P202-P264-P273-P301+P312-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-51/53 |
| Safety Statements | 60 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Repr. 2 |






