A8553432
Phe-Gly hydrate , ≥95% , 721-90-4
Synonym(s):
L -Phenylalanyl-glycine hydrate
CAS NO.:721-90-4
Empirical Formula: C11 H14 N2 O3
Molecular Weight: 222.24
MDL number: MFCD00021728
EINECS: 222-027-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB263.20 | In Stock |
|
| 1g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~260 °C (dec.) |
| Boiling point: | 512.5±50.0 °C(Predicted) |
| Density | 1.259±0.06 g/cm3(Predicted) |
| storage temp. | -15°C |
| solubility | Methanol (Slightly), Water (Sparingly, Sonicated) |
| pka | 3.13±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D +103±3°, c = 1% in H2O |
| BRN | 2218143 |
| Stability: | Hygroscopic |
| Major Application | peptide synthesis |
| InChI | 1S/C11H14N2O3.H2O/c12-9(11(16)13-7-10(14)15)6-8-4-2-1-3-5-8;/h1-5,9H,6-7,12H2,(H,13,16)(H,14,15);1H2/t9-;/m0./s1 |
| InChIKey | QNLAQUFDXQTNOW-FVGYRXGTSA-N |
| SMILES | O.N[C@@H](Cc1ccccc1)C(=O)NCC(O)=O |
Description and Uses
Phenylalanylglycine can be used to mask unpleasant taste impressions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P270-P271-P280-P301+P312-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P330-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| Storage Class | 11 - Combustible Solids |






