BD0055856
N-(4-Amino-2,5-dimethoxyphenyl)benzamide , 97% , 6268-05-9
Synonym(s):
4-Benzoylamino-2,5-dimethoxyaniline;Azoic Diazo No. 24
CAS NO.:6268-05-9
Empirical Formula: C15H16N2O3
Molecular Weight: 272.3
MDL number: MFCD00008369
EINECS: 228-441-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB53.60 | In Stock |
|
| 5g | RMB209.60 | In Stock |
|
| 25g | RMB880.00 | In Stock |
|
| 250g | RMB8000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-168 °C(lit.) |
| Boiling point: | 378.2±42.0 °C(Predicted) |
| Density | 1.245±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 12.05±0.70(Predicted) |
| form | solid |
| Colour Index | 37155 |
| λmax | 323 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C15H16N2O3/c1-19-13-9-12(14(20-2)8-11(13)16)17-15(18)10-6-4-3-5-7-10/h3-9H,16H2,1-2H3,(H,17,18) |
| InChIKey | DDRCIGNRLHTTIW-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1N |
| CAS DataBase Reference | 6268-05-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzamide, N-(4-amino-2,5-dimethoxyphenyl)- (6268-05-9) |
Description and Uses
N-(4-Amino-2,5-dimethoxyphenyl)benzamide is used in preparation of Indazoles that inhibit one or more receptor, or non-receptor, tyrosine or serine/threonine kinase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![Azoic Diazo Component 24 (Salt) [for Biochemical Research]](https://img.chemicalbook.com/CAS/GIF/55663-99-5.gif)