BD0231248
2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)-2-(pyridin-3-yl)aceticacid , 95+% , 885274-51-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB3673.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 461.6±45.0 °C(Predicted) |
| Density | 1.240±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 1.19±0.10(Predicted) |
| form | powder or crystals |
| color | white to faint beige |
| Major Application | peptide synthesis |
| InChI | 1S/C16H23N3O4/c1-16(2,3)23-15(22)19-9-7-18(8-10-19)13(14(20)21)12-5-4-6-17-11-12/h4-6,11,13H,7-10H2,1-3H3,(H,20,21) |
| InChIKey | UOZAIRMXJCRTJN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(C(O)=O)c2cccnc2 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
![[4-(tert-butoxycarbonyl)piperazin-1-yl]acetic acid](https://img.chemicalbook.com/CAS/GIF/156478-71-6.gif)
