BD0270753
3-Hydroxy-2-naphthohydrazide , 98% , 5341-58-2
Synonym(s):
3-Hydroxy-2-naphthydrazide
CAS NO.:5341-58-2
Empirical Formula: C11H10N2O2
Molecular Weight: 202.21
MDL number: MFCD00004097
EINECS: 226-282-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB82.40 | In Stock |
|
| 25g | RMB260.00 | In Stock |
|
| 100g | RMB914.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-208 °C (lit.)
205-208 °C |
| Boiling point: | 340.32°C (rough estimate) |
| Density | 1.352 |
| refractive index | 1.5300 (estimate) |
| storage temp. | RT, stored under nitrogen |
| form | Powder |
| pka | 8.86±0.40(Predicted) |
| color | Beige |
| BRN | 395153 |
| InChI | InChI=1S/C11H10N2O2/c12-13-11(15)9-5-7-3-1-2-4-8(7)6-10(9)14/h1-6,14H,12H2,(H,13,15) |
| InChIKey | FDNAQCWUERCJBK-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(O)=C1C(NN)=O |
| CAS DataBase Reference | 5341-58-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Naphthalenecarboxylic acid, 3-hydroxy-, hydrazide (5341-58-2) |
Description and Uses
3-Hydroxy-2-naphthoic hydrazide may be used to synthesize the following 2-(alkyl/arylamino)-5-(3-hydroxy-2-naphthyl)-1,3,4-thiadiazoles:
- 2-ethylamino-5-(3-hydroxy-2-naphthyl)-1,3,4-thiadiazole
- 2-phenethylamino-5-(3-hydroxy-2-naphthyl)-1,3,4-thiadiazole
- 2-phenylamino-5-(3-hydroxy-2-naphthyl)-1,3,4-thiadiazole
- 2-(p-bromophenylamino)-5-(3-hydroxy-2-naphthyl)-1,3,4-thiadiazole
- 2-(p-chlorophenylamino)-5-(3-hydroxy-2-naphthyl)-1,3,4-thiadiazole
- 2-(p-fluorophenylamino)-5-(3-hydroxy-2-naphthyl)-1,3,4-thiadiazole
- 2-(m-fluorophenylamino)-5-(3-hydroxy-2-naphthyl)-1,3,4-thiadiazole
- 2-(p-methoxyphenylamino)-5-(3-hydroxy-2-naphthyl)-1,3,4-thiadiazole
- 2-(p-methylphenylamino)-5-(3-hydroxy-2-naphthyl)-1,3,4-thiadiazole
- 2-(m-trifluoromethylphenylamino)-5-(3-hydroxy-2-naphthyl)-1,3,4-thiadiazole
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-9-23 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29280090 |






