BD0275053
(S)-2-((S)-2-Acetamido-3-carboxypropanamido)pentanedioicacid , 95% , 3106-85-2
Synonym(s):
NAAG;NAAG - CAS 3106-85-2 - Calbiochem;N-Acetyl-Asp-Glu, N-acetylaspartylglutamate;Spaglumic acid;Spaglumic acid
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB357.60 | In Stock |
|
| 50mg | RMB572.00 | In Stock |
|
| 100mg | RMB914.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-173 °C |
| Boiling point: | 769.5±60.0 °C(Predicted) |
| Density | 1.472±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| pka | 3.04±0.10(Predicted) |
| color | white |
| optical activity | [α]22/D 34.5°, c = 1.1 in H2O(lit.) |
| Water Solubility | Soluble to 100 mM in water |
| Stability: | Hygroscopic |
| InChI | 1S/C11H16N2O8/c1-5(14)12-7(4-9(17)18)10(19)13-6(11(20)21)2-3-8(15)16/h6-7H,2-4H2,1H3,(H,12,14)(H,13,19)(H,15,16)(H,17,18)(H,20,21) |
| InChIKey | OPVPGKGADVGKTG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC(O)=O)C(=O)NC(CCC(O)=O)C(O)=O |
Description and Uses
N-Acetyl-Asp-Glu has been used in N-acetylated α-linked acidic dipeptidase (NAALADase) assay and affinity experiments.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
