PRODUCT Properties
| Melting point: | >300°C (dec.) |
| Boiling point: | 574.3±50.0 °C(Predicted) |
| Density | 1.512±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated and Sonicated) |
| pka | 6.49±0.40(Predicted) |
| form | Solid |
| color | Yellow to Very Dark Yellow |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C16H12O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h2-7,17-19H,1H3 |
| InChIKey | SCZVLDHREVKTSH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(O)C(OC)=C2)OC2=CC(O)=CC(O)=C2C(=O)C=1 |
| LogP | 2.229 (est) |
Description and Uses
Chrysoeriol is a methoxyflavonoid that selectively inhibits the formation of a carcinogenic estrogen metabolite in MCF-7 breast cancer cells. A metabolite of Luteolin (L475000).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P362+P364-P332+P313-P337+P313-P403+P233-P405-P501 |
