BD0385648
1-Methyl-4-nitro-1H-pyrrole-2-carboxylicacid , 98+% , 13138-78-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB899.20 | In Stock |
|
| 1g | RMB1726.40 | In Stock |
|
| 5g | RMB5189.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204 °C |
| Boiling point: | 367.1±27.0 °C(Predicted) |
| Density | 1.54±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder |
| pka | 3.49±0.41(Predicted) |
| BRN | 168975 |
| InChI | 1S/C6H6N2O4/c1-7-3-4(8(11)12)2-5(7)6(9)10/h2-3H,1H3,(H,9,10) |
| InChIKey | GEGNYFQOFWUIFG-UHFFFAOYSA-N |
| SMILES | Cn1cc(cc1C(O)=O)[N+]([O-])=O |
Description and Uses
1-Methyl-4-nitropyrrole-2-carboxylic Acid is used in the synthesis of Lexitropsin and distamycin analogs with antimicrobial activities.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






