BD1781248
Methyl1-methyl-4-nitro-1H-pyrrole-2-carboxylate , 98% , 13138-76-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB75.20 | In Stock |
|
| 5g | RMB261.60 | In Stock |
|
| 25g | RMB914.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113 °C |
| Boiling point: | 305.2±22.0 °C(Predicted) |
| Density | 1.36±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | -12.72±0.70(Predicted) |
| form | solid |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C7H8N2O4/c1-8-4-5(9(11)12)3-6(8)7(10)13-2/h3-4H,1-2H3 |
| InChIKey | SEOKAHOXOYKYKS-UHFFFAOYSA-N |
| SMILES | N1(C)C=C([N+]([O-])=O)C=C1C(OC)=O |
Description and Uses
Methyl 1-Methyl-4-nitro-1H-pyrrole-2-carboxylate is used in preparation of Aminoglycosides as DNA binding agents with minor groove binding tail.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






