BD0386445
4-Hydroxy-3,5-diisopropylbenzoicacid , 95% , 13423-73-9
CAS NO.:13423-73-9
Empirical Formula: C13H18O3
Molecular Weight: 222.28
MDL number:
EINECS: 248-592-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB148.00 | In Stock |
|
| 250mg | RMB220.80 | In Stock |
|
| 1g | RMB556.00 | In Stock |
|
| 5g | RMB1936.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146 °C |
| Boiling point: | 343.5±42.0 °C(Predicted) |
| Density | 1.108±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Heated), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.65±0.10(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C13H18O3/c1-7(2)10-5-9(13(15)16)6-11(8(3)4)12(10)14/h5-8,14H,1-4H3,(H,15,16) |
| InChIKey | WYAZPCLFZZTVSP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C(C)C)=C(O)C(C(C)C)=C1 |
Description and Uses
Propofol 4-Carboxylic Acid (Propofol EP Impurity N) is a related compound of Propofol (P829750), as an antioxidant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P304+P340+P312-P305+P351+P338-P337+P313-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |






![4-Isopropyl-2,2-dimethylbenzo[d][1,3]dioxole](https://img.chemicalbook.com/CAS/GIF/201166-22-5.gif)
