BD0405253
(R)-tert-Butyl2-hydroxypropanoate , 97% , 68166-83-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB235.20 | In Stock |
|
| 250mg | RMB513.60 | In Stock |
|
| 1g | RMB1568.00 | In Stock |
|
| 5g | RMB7200.00 | In Stock |
|
| 100g | RMB20000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-42 °C |
| Boiling point: | 161.8±8.0 °C(Predicted) |
| Density | 1.004±0.06 g/cm3(Predicted) |
| Flash point: | 113 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| pka | 13.07±0.20(Predicted) |
| form | Solid |
| color | Off-White |
| optical activity | [α]20/D +7.3±0.5°, c = 1.7% in methylene chloride |
| BRN | 1722069 |
| InChI | InChI=1S/C7H14O3/c1-5(8)6(9)10-7(2,3)4/h5,8H,1-4H3/t5-/m1/s1 |
| InChIKey | IXXMVXXFAJGOQO-RXMQYKEDSA-N |
| SMILES | C(OC(C)(C)C)(=O)[C@H](O)C |
Description and Uses
(R)-tert-Butyl 2-hydroxypropanoate is an intermediate used in the stereo controlled synthesis of hydroxy carboxylic acids from L-amino acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3 |






