BD0436448
1,2-Bis(bis(perfluorophenyl)phosphino)ethane , 98% , 76858-94-1
Synonym(s):
1,2-Bis(dipentafluorophenylphosphino)ethane;1,2-Ethanediylbis[bis(pentafluorophenyl)phosphine;Bis(dipentafluorophenylphosphine)ethane;Dfppe
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB164.80 | In Stock |
|
| 250mg | RMB280.00 | In Stock |
|
| 1g | RMB728.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-195 °C(lit.) |
| Boiling point: | 494.2±45.0 °C(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder |
| color | White to light beige |
| Water Solubility | Insoluble in water. |
| InChIKey | IGLFIYOFKVGEBP-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(P(CCP(c2c(F)c(F)c(F)c(F)c2F)c3c(F)c(F)c(F)c(F)c3F)c4c(F)c(F)c(F)c(F)c4F)c(F)c1F |
| CAS DataBase Reference | 76858-94-1(CAS DataBase Reference) |
Description and Uses
It finds it application as a pharmaceutical intermediate and intermediate in organic syntheses.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H315-H319-H301-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| RIDADR | UN3464 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |







