BD0465848
4-(tert-Butyl)benzothioamide , 98% , 57774-77-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB3265.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-148 °C |
| Boiling point: | 288.7±33.0 °C(Predicted) |
| Density | 1.058±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 12.78±0.29(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C11H15NS/c1-11(2,3)9-6-4-8(5-7-9)10(12)13/h4-7H,1-3H3,(H2,12,13) |
| InChIKey | HZODWYBXBKXJLB-UHFFFAOYSA-N |
| SMILES | C1(C(N)=S)=CC=C(C(C)(C)C)C=C1 |
| CAS DataBase Reference | 57774-77-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22-43-36 |
| Safety Statements | 37/39-26-36/37 |
| RIDADR | UN2811 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 2930909899 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
