![5-Bromobenzo[de]isochromene-1,3-dione](https://img.chemicalbook.com/CAS/GIF/24050-49-5.gif)
BD0467853
5-Bromobenzo[de]isochromene-1,3-dione , 95% , 24050-49-5
CAS NO.：24050-49-5
Empirical Formula: C12H5BrO3
Molecular Weight: 277.07
MDL number: MFCD00228162
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB140.00 | In Stock |
|
| 250mg | RMB242.40 | In Stock |
|
| 1g | RMB652.80 | In Stock |
|
| 5g | RMB2697.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 244-246°C |
| Boiling point: | 468.9±28.0 °C(Predicted) |
| Density | 1.812±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Store at room temperature |
| Appearance | White to yellow Solid |
| Sensitive | Moisture Sensitive |
| BRN | 180001 |
| InChI | InChI=1S/C12H5BrO3/c13-7-4-6-2-1-3-8-10(6)9(5-7)12(15)16-11(8)14/h1-5H |
| InChIKey | LYXFXCSFCWZGNZ-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)C2=CC(Br)=CC3=C2C1=CC=C3 |
Description and Uses
3-Bromo-1,8-naphthalic anhydride is a naphthalic anhydride compound. Its structure incorporates a bromo functional group, meaning this product can participate in various chemical reactions and serve as a synthetic reagent for preparing photocatalysts, pharmaceutical preparations, or other organic heterocyclic compounds.
3-Bromo-1,8-naphthalic Anhydride is used in the preparation of novel NK1/NK2 antagonists. Also used in the synthesis of antitumor active a;lanediamines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
