BD0467953
N-Methylaniline2,2,2-trifluoroacetate , 98% , 29885-95-8
Synonym(s):
TAMA;Trifluoroacetic acid N-methylaniline salt
CAS NO.：29885-95-8
Empirical Formula: C9H10F3NO2
Molecular Weight: 221.18
MDL number: MFCD00043278
EINECS: 249-927-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB65.60 | In Stock |
|
| 5g | RMB228.80 | In Stock |
|
| 25g | RMB800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-66 °C (lit.) |
| Density | 1.2770 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Grey to Dark Grey |
| Sensitive | Hygroscopic |
| BRN | 3638133 |
| InChI | 1S/C7H9N.C2HF3O2/c1-8-7-5-3-2-4-6-7;3-2(4,5)1(6)7/h2-6,8H,1H3;(H,6,7) |
| InChIKey | TXXJGCVOHDSYBC-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)F.CNc1ccccc1 |
| CAS DataBase Reference | 29885-95-8(CAS DataBase Reference) |
Description and Uses
N-Methylaniline Trifluoroacetate is regent used in organic synthesis, functioning as an α-methylating agent for ketones and activates internucleodecoupling upon removal.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332-H373-H401-H411 |
| Precautionary statements | P260-P280h-P301+P312a-P304+P340-P321-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 1-9 |
| HS Code | 2921.42.9000 |
| HazardClass | 9 |
| Storage Class | 11 - Combustible Solids |
