BD0472053
2,3-Dimethyl-2H-indazol-6-amine , 97% , 444731-72-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5g | RMB107.20 | In Stock |
|
| 25g | RMB397.60 | In Stock |
|
| 100g | RMB1323.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 366.9±22.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.20±0.30(Predicted) |
| form | Solid |
| color | Dark Brown to Very Dark Orange |
| InChI | InChI=1S/C9H11N3/c1-6-8-4-3-7(10)5-9(8)11-12(6)2/h3-5H,10H2,1-2H3 |
| InChIKey | PVNVSSNARYHLRF-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=CC(N)=C2)=C(C)N1C |
Description and Uses
2,3-Dimethyl-6-amino-2H-indazole is an impurity in the synthesis of Pazopanib (P210925) hydrochloride, an oral angiogenesis inhibitor targeting VEGFR and PDGFR.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| HS Code | 2922390090 |
