BD0473745
2,4,6-Trifluoropyridine , 95% , 3512-17-2
CAS NO.：3512-17-2
Empirical Formula: C5H2F3N
Molecular Weight: 133.07
MDL number: MFCD03001161
EINECS: 680-289-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB145.60 | In Stock |
|
| 5g | RMB314.40 | In Stock |
|
| 10g | RMB591.20 | In Stock |
|
| 25g | RMB1389.60 | In Stock |
|
| 100g | RMB4916.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 102°C |
| Density | 1,499 g/cm3 |
| refractive index | 1.412 |
| Flash point: | 17°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -7.23±0.10(Predicted) |
| form | liquid |
| Specific Gravity | 1.499 |
| color | Clear, colourless |
| BRN | 1364338 |
| InChI | InChI=1S/C5H2F3N/c6-3-1-4(7)9-5(8)2-3/h1-2H |
| InChIKey | UZDRWXKBKVVUTE-UHFFFAOYSA-N |
| SMILES | C1(F)=NC(F)=CC(F)=C1 |
| CAS DataBase Reference | 3512-17-2(CAS DataBase Reference) |
Description and Uses
2,4,6-Trifluoropyridine is an intermediate in the synthesis of pharmaceutical goods.
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H225-H314-H318 |
| Precautionary statements | P210-P280-P303+P361+P353-P305+P351+P338-P310 |
| Hazard Codes | C,F,Xi |
| Risk Statements | 11-34-41-37/38 |
| Safety Statements | 16-26-36/37/39-45-39 |
| RIDADR | 1993 |
| Hazard Note | Corrosive/Highly Flammable |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 2933399990 |
