BD0492945
VidarabineH2O , 98% , 24356-66-9
CAS NO.：24356-66-9
Empirical Formula: C10H15N5O5
Molecular Weight: 285.257
MDL number: MFCD00065471
EINECS: 678-339-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB143.20 | In Stock |
|
| 250mg | RMB242.40 | In Stock |
|
| 1g | RMB652.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 253 °C |
| Boiling point: | 427.69°C (rough estimate) |
| Density | 1.3439 (rough estimate) |
| refractive index | -3.0 ° (C=1, DMF) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 513.5mg/L(temperature not stated) |
| Merck | 14,9976 |
| InChI | 1S/C10H13N5O4.H2O/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);1H2/t4-,6-,7+,10-;/m1./s1 |
| InChIKey | ZTHWFVSEMLMLKT-CAMOTBBTSA-N |
| SMILES | NC1=NC=NC2=C1N=CN2[C@@H]3O[C@@H]([C@H]([C@@H]3O)O)CO.O |
Description and Uses
Antiviral.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H361 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501 |
| Risk Statements | 62 |
| Safety Statements | 45-53-36/37 |
| WGK Germany | WGK 3 |
| RTECS | AU6200000 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 |
