BD0516332
(R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpropanoic acid , 97% , 211682-15-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB349.60 | In Stock |
|
| 250mg | RMB519.20 | In Stock |
|
| 1g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 555.3±33.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder |
| pka | 4.48±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]/D -10.5±1°, c = 1 in DMF |
| Major Application | peptide synthesis |
| InChI | 1S/C19H19NO4/c1-12(18(21)22)10-20-19(23)24-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,12,17H,10-11H2,1H3,(H,20,23)(H,21,22)/t12-/m1/s1 |
| InChIKey | BMUDOYSTGJHGNI-GFCCVEGCSA-N |
| SMILES | C[C@H](CNC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






