![Oxazolo[4,5-b]pyridin-2(3H)-one](https://img.chemicalbook.com/CAS/GIF/60832-72-6.gif)
BD0528132
Oxazolo[4,5-b]pyridin-2(3H)-one , 97% , 60832-72-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB27.20 | In Stock |
|
| 5g | RMB38.40 | In Stock |
|
| 10g | RMB57.60 | In Stock |
|
| 25g | RMB115.20 | In Stock |
|
| 100g | RMB330.40 | In Stock |
|
| 500g | RMB1004.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214 °C |
| Boiling point: | 253.8±23.0 °C(Predicted) |
| Density | 1.59±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| pka | 2.76±0.20(Predicted) |
| form | Solid |
| color | Tan |
| InChI | InChI=1S/C6H4N2O2/c9-6-8-5-4(10-6)2-1-3-7-5/h1-3H,(H,7,8,9) |
| InChIKey | OVLXOTUWFLHWQT-UHFFFAOYSA-N |
| SMILES | C12NC(=O)OC1=CC=CN=2 |
| CAS DataBase Reference | 60832-72-6(CAS DataBase Reference) |
Description and Uses
2,3-Dihydropyrido[2,3-d][1,3]oxazol-2-one is a benzoxazolone analogue that may be used to inhibit the nitric oxide synthases (NOS).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-36-22 |
| Safety Statements | 22-26-36/37/39 |
| Hazard Note | Harmful |
| HS Code | 2934999090 |
