BD0567353
2-Oxopropanaloxime , 98+% , 306-44-5
Synonym(s):
Isonitrosoacetone
CAS NO.:306-44-5
Empirical Formula: C3H5NO2
Molecular Weight: 87.08
MDL number: MFCD00002123
EINECS: 206-184-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB96.00 | In Stock |
|
| 1g | RMB248.00 | In Stock |
|
| 5g | RMB724.80 | In Stock |
|
| 25g | RMB2566.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69° |
| Boiling point: | 160.87°C (rough estimate) |
| Density | 1.0744 |
| refractive index | 1.4940 (estimate) |
| storage temp. | Storage temp. -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | pK (25°) 8.39 |
| color | Brown |
| InChI | InChI=1S/C3H5NO2/c1-3(5)2-4-6/h2,6H,1H3 |
| InChIKey | OVGLVOLWBBGQHS-UHFFFAOYSA-N |
| SMILES | C(=NO)C(=O)C |
| EPA Substance Registry System | Propanal, 2-oxo-, 1-oxime (306-44-5) |
Description and Uses
(E)-2-oxopropanal oxime can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development processes and pharmaceutical and chemical production processes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Danger |
| Hazard statements | H335-H301-H315-H319 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |






![(1S,4R,E)-3-(hydroxyimino)-1,7,7-trimethylbicyclo[2.2.1]Heptan-2-one](https://img.chemicalbook.com/CAS/GIF/251645-83-7.gif)

