F413722
Isonitrosoacetophenone , 97 , 532-54-7
Synonym(s):
ω-(Hydroxyimino)acetophenone;ω-Isonitrosoacetophenone;Phenylglyoxaldoxime
CAS NO.：532-54-7
Empirical Formula: C8H7NO2
Molecular Weight: 149.15
MDL number: MFCD00002122
EINECS: 208-539-5
| Pack Size | Price | Stock | Quantity |
| 10g | RMB1178.40 | In Stock |
|
| 50g | RMB2826.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-128 °C (lit.) |
| Boiling point: | 270.21°C (rough estimate) |
| Density | 1.2517 (rough estimate) |
| refractive index | 1.5320 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 8.49±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Water Solubility | SOLUBLE IN COLD WATER |
| Merck | 14,5191 |
| BRN | 2041691 |
| InChI | InChI=1S/C8H7NO2/c10-8(6-9-11)7-4-2-1-3-5-7/h1-6,11H/b9-6+ |
| InChIKey | MLNKXLRYCLKJSS-RMKNXTFCSA-N |
| SMILES | C1(C=CC=CC=1)C(=O)/C=N/O |
| CAS DataBase Reference | 532-54-7(CAS DataBase Reference) |
| EPA Substance Registry System | Isonitrosoacetophenone (532-54-7) |
Description and Uses
As a reagent for the detection of ferrous ions with which it gives a blue color soluble in chloroform.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312a-P330-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | MD3325000 |
| TSCA | Yes |
| HS Code | 2922390090 |
