BD0569332
(2S,3S)-Dibenzyl 2,3-dihydroxysuccinate , 97% , 4136-22-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB124.80 | In Stock |
|
| 5g | RMB436.00 | In Stock |
|
| 25g | RMB1524.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-68 °C |
| Boiling point: | 480.9±25.0 °C(Predicted) |
| Density | 1.312±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 11.38±0.20(Predicted) |
| form | powder |
| optical activity | [α]20/D 12.5±1°, c = 1.1% in acetone |
| BRN | 4787873 |
| InChI | 1S/C18H18O6/c19-15(17(21)23-11-13-7-3-1-4-8-13)16(20)18(22)24-12-14-9-5-2-6-10-14/h1-10,15-16,19-20H,11-12H2/t15-,16-/m0/s1 |
| InChIKey | LCKIPSGLXMCAOF-HOTGVXAUSA-N |
| SMILES | O[C@@H]([C@H](O)C(=O)OCc1ccccc1)C(=O)OCc2ccccc2 |
Description and Uses
(-)-Dibenzyl D-tartrate can be employed as a reactant to synthesize:
- 2,3-bis(8-Methoxyoctanoyl) dibenzyl tartrate (DBT) by reacting with 8-methoxyoctanoic acid in the presence of 1-ethyl-3-(3-(dimethylamino)propyl)carbodiimide (EDCI) as a coupling reagent.
- (-)-Chicoric acid (2,3-bis{[3-(3,4-dihydroxyphenyl)-1-oxoprop-2-enyl]oxy}butanedioic acid), as a potent inhibitor.
- Diesters of aziridine-2,3-dicarboxylic acid derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-9 |
| Storage Class | 11 - Combustible Solids |






