BD0583048
2-Hydroxy-2-(3-phenoxyphenyl)acetonitrile , 97%containinglessthan10%EA , 39515-47-4
CAS NO.:39515-47-4
Empirical Formula: C14H11NO2
Molecular Weight: 225.25
MDL number: MFCD00001861
EINECS: 254-486-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB251.20 | In Stock |
|
| 250mg | RMB402.40 | In Stock |
|
| 1g | RMB674.40 | In Stock |
|
| 5g | RMB2603.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79℃ (ethanol ) |
| Boiling point: | 399.8±32.0 °C(Predicted) |
| Density | 1.220±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform, DMSO |
| form | Oil |
| pka | 10.33±0.20(Predicted) |
| color | Clear Yellow |
| Stability: | Unstable in Solution |
| InChI | InChI=1S/C14H11NO2/c15-10-14(16)11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9,14,16H |
| InChIKey | GXUQMKBQDGPMKZ-UHFFFAOYSA-N |
| SMILES | O(C1C=CC=CC=1)C1C=CC=C(C(O)C#N)C=1 |
| EPA Substance Registry System | Benzeneacetonitrile, .alpha.-hydroxy-3-phenoxy- (39515-47-4) |
Description and Uses
α-Hydroxy-3-phenoxybenzeneacetonitrile is an intermediate in synthesizing τ-Fluvalinate (F601100), a synthetic pyrethroid aracacide. τ-Fluvalinate is commonly used to control Varroa jacobsoni (a parasitic mite) in honey bee colonies.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H331-H310-H301-H226-H314 |
| Precautionary statements | P261-P271-P304+P340-P311-P321-P403+P233-P405-P501-P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501-P262-P264-P270-P280-P302+P350-P310-P322-P361-P363-P405-P501-P264-P270-P301+P310-P321-P330-P405-P501 |
| TSCA | TSCA listed |








