S1904049
Flucythrinate , PESTANAL ,analyticalstandard,mixtureofstereoisomers , 70124-77-5
Synonym(s):
α-Cyano-3-phenoxybenzyl 4-difluoromethoxy-α-isopropylphenylacetate
CAS NO.:70124-77-5
Empirical Formula: C26H23F2NO4
Molecular Weight: 451.47
MDL number: MFCD00137383
EINECS: 274-322-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1379.51 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25℃ |
| Boiling point: | 108℃ (0.35mmHg) |
| Density | 1.189 g/cm3 (22℃) |
| vapor pressure | 1.2×10-6 Pa (25 °C) |
| refractive index | 1.541 (589.3 nm 25℃) |
| Flash point: | -18 °C |
| storage temp. | 2-8°C |
| Water Solubility | 0.5 mg l-1 (22 °C) |
| Specific Gravity | 1.189 (22℃) |
| BRN | 2195795 |
| Major Application | agriculture |
| InChI | 1S/C26H23F2NO4/c1-17(2)24(18-11-13-21(14-12-18)32-26(27)28)25(30)33-23(16-29)19-7-6-10-22(15-19)31-20-8-4-3-5-9-20/h3-15,17,23-24,26H,1-2H3 |
| InChIKey | GBIHOLCMZGAKNG-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c3ccc(OC(F)F)cc3 |
| CAS DataBase Reference | 70124-77-5(CAS DataBase Reference) |
| EPA Substance Registry System | Flucythrinate (70124-77-5) |
Description and Uses
Nonsystemic insecticide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H226-H301-H332-H410 |
| Precautionary statements | P210-P233-P240-P273-P301+P310-P304+P340+P312 |
| target organs | Respiratory system |
| Hazard Codes | T,N,Xn,F |
| Risk Statements | 20/21-25-50/53-67-65-38-11 |
| Safety Statements | 36/37-45-60-61-62 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CY1578620 |
| HS Code | 29269090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 70124-77-5(Hazardous Substances Data) |
| Toxicity | LC50 (96-hour) for rainbow trout 0.32 μg/L, bluegill sun?sh 0.71 μg/L, channel cat?sh 0.51 μg/L, sheepshead minnow 1.6 μg/L (Hartley and Kidd, 1987), estuarine mysid 0.008 μg/L, pink shrimp 0.22 μg/L and sheepshead minnow 1.1 μg/L (Schimmel et al., 1983); acute oral LD50 for male and female rats is 81 and 67 mg/kg, respectively (Hartley and Kidd, 1987). |








