BD0609932
Methyl 2-(2-aminothiazol-4-yl)acetate , 95% , 64987-16-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB29.60 | In Stock |
|
| 1g | RMB69.60 | In Stock |
|
| 5g | RMB206.40 | In Stock |
|
| 10g | RMB398.40 | In Stock |
|
| 25g | RMB709.60 | In Stock |
|
| 100g | RMB1778.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-116 °C(lit.) |
| Boiling point: | 307.3±17.0 °C(Predicted) |
| Density | 1.353±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | solid |
| pka | 3.61±0.10(Predicted) |
| Appearance | Light yellow to light brown Solid |
| InChI | InChI=1S/C6H8N2O2S/c1-10-5(9)2-4-3-11-6(7)8-4/h3H,2H2,1H3,(H2,7,8) |
| InChIKey | XTQKFBGFHDNUFY-UHFFFAOYSA-N |
| SMILES | S1C=C(CC(OC)=O)N=C1N |
| CAS DataBase Reference | 64987-16-2 |
Description and Uses
Methyl 2-Amino-4-thiazoleacetate is a reactant in the preparation of N-[4-(substituted)-1,3-thiazol-2-yl]-2-(substituted)acetamides as antibacterial agents against S. aureus, E. coli, P. aeruginosa, and K. pneumonia.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








