BD0627332
Methyl 4-bromo-2,6-difluorobenzoate , 98% , 773134-11-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB58.40 | In Stock |
|
| 10g | RMB104.80 | In Stock |
|
| 25g | RMB222.40 | In Stock |
|
| 100g | RMB826.40 | In Stock |
|
| 500g | RMB3830.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-43℃ |
| Boiling point: | 276.1±40.0 °C(Predicted) |
| Density | 1.652±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | White to light brown Solid |
| InChI | InChI=1S/C8H5BrF2O2/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3H,1H3 |
| InChIKey | JBXJLZRTTCGLNR-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=C(F)C=C(Br)C=C1F |
Description and Uses
Methyl 4-bromo-2,6-difluorobenzoate is a pharmaceutical intermediate compound used in the preparation of contraceptive compositions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
