BD0643632
1-Bromo-3-fluoro-2-nitrobenzene , 98% , 886762-70-5
CAS NO.：886762-70-5
Empirical Formula: C6H3BrFNO2
Molecular Weight: 220
MDL number: MFCD07368788
EINECS: 689-316-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB95.20 | In Stock |
|
| 10g | RMB178.40 | In Stock |
|
| 25g | RMB391.20 | In Stock |
|
| 100g | RMB1501.60 | In Stock |
|
| 500g | RMB7324.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-37°C |
| Boiling point: | 232.0±20.0 °C(Predicted) |
| Density | 1.808±0.06 g/cm3(Predicted) |
| Flash point: | 87° |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to lump |
| color | White to Orange to Green |
| InChI | InChI=1S/C6H3BrFNO2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H |
| InChIKey | VFPAOFBPEYCAAZ-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(F)=C1[N+]([O-])=O |
Description and Uses
2-Bromo-6-fluoronitrobenzene is a hydrocarbon derivative, mainly used as an organic intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 36 |
| HazardClass | IRRITANT |
| HS Code | 29042090 |
