A7971212
2,3,4-Trifluoronitrobenzene , >98.0%(GC) , 771-69-7
Synonym(s):
1,2,3-Trifluoro-4-nitrobenzene;4-Nitro-1,2,3-trifluorobenzene
CAS NO.:771-69-7
Empirical Formula: C6H2F3NO2
Molecular Weight: 177.08
MDL number: MFCD00041546
EINECS: 212-238-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB20.00 | In Stock |
|
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB60.80 | In Stock |
|
| 500G | RMB268.00 | In Stock |
|
| 2.5kg | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 92 °C/20 mmHg (lit.) |
| Density | 1.541 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 200 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| Specific Gravity | 1.541 |
| BRN | 2449746 |
| InChI | InChI=1S/C6H2F3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| InChIKey | ARCACZWMYGILNI-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C([N+]([O-])=O)C(F)=C1F |
| CAS DataBase Reference | 771-69-7(CAS DataBase Reference) |
Description and Uses
2,3,4-Trifluoronitrobenzene was employed as starting reagent in the synthesis of ofloxacin. It was also used in the synthesis of the third generation quinolones antibacterial drugs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29042090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






