BD0672732
2-Boc-Aminothiazole-5-carboxylic acid , 97% , 302964-02-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB40.00 | In Stock |
|
| 5g | RMB197.60 | In Stock |
|
| 10g | RMB277.60 | In Stock |
|
| 25g | RMB674.40 | In Stock |
|
| 100g | RMB2650.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-222°(dec) |
| Density | 1.406±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 5.53±0.70(Predicted) |
| color | White to Almost white |
| InChI | 1S/C9H12N2O4S/c1-9(2,3)15-8(14)11-7-10-4-5(16-7)6(12)13/h4H,1-3H3,(H,12,13)(H,10,11,14) |
| InChIKey | QNFLEDLPOVONCN-UHFFFAOYSA-N |
| SMILES | [s]1c(ncc1C(=O)O)NC(=O)OC(C)(C)C |
| CAS DataBase Reference | 302964-02-9 |
Description and Uses
A reactant used in the preparation of 2-aminocarboxamidothiazoles as inhibitors of Src-family kinase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| Hazard Codes | Xi |
| Risk Statements | 43-36/37/38 |
| Safety Statements | 36/37-36-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
![TAR [=4-(2-Thiazolylazo)resorcinol] [Metal indicator and spectrophotometric reagent for transition metals]](https://img.chemicalbook.com/CAS/GIF/2246-46-0.gif)
