BD0698053
2-(4-Isobutylphenyl)propan-1-ol , 95% , 36039-36-8
Synonym(s):
β-Methyl-4-(2-methylpropyl)benzeneethanol;2-(4-Isobutylphenyl)propanol;2-(4-Isobutylphenyl)propyl alcohol;Ibuprofen alcohol;Ibuprofen Impurity F (Ph. Eur.)
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB204.00 | In Stock |
|
| 250mg | RMB346.40 | In Stock |
|
| 1g | RMB933.60 | In Stock |
|
| 5g | RMB3265.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 104 °C(Press: 0.8 Torr) |
| Density | 0.946±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| pka | 14.82±0.10(Predicted) |
| color | Colourless to Pale Yellow |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C13H20O/c1-10(2)8-12-4-6-13(7-5-12)11(3)9-14/h4-7,10-11,14H,8-9H2,1-3H3 |
| InChIKey | IZXWIWYERZDWOA-UHFFFAOYSA-N |
| SMILES | C1(C(C)CO)=CC=C(C=C1)CC(C)C |
Description and Uses
Ibuprofen Alcohol (Ibuprofen EP Impurity P) is an impurity of Ibuprofen (I140000). Ibuprofen impurity P as per EP.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313-P362 |
| WGK Germany | WGK 3 |
| Storage Class | 12 - Non Combustible Liquids |







