LN1974253
97% , 115075-59-7
Synonym(s):
Ibuprofen glucuronide
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB1316.00 | In Stock |
|
| 5mg | RMB3668.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 26-28°C |
| Boiling point: | 567.3±50.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | Acetonitrile (Slightly, Heated), DMSO (Slightly), Methanol (Slightly, Sonicated) |
| pka | 2.68±0.70(Predicted) |
| color | White to Pale Yellow |
| Stability: | Hygroscopic, Not stable in aqueous solutions. |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChIKey | ABOLXXZAJIAUGR-JPMMFUSZSA-N |
| SMILES | CC(C)Cc1ccc(cc1)C(C)C(=O)O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O |
Description and Uses
Ibuprofen Acyl-β-D-glucuronide (mixture of diastereomers) (cas# 115075-59-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| WGK Germany | 3 |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |







