BD0712553
rel-1-(4-(((2R,4S)-2-((1H-Imidazol-1-yl)methyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl)methoxy)phenyl)piperazine , 95% , 67914-61-8
CAS NO.：67914-61-8
Empirical Formula: C24H26Cl2N4O3
Molecular Weight: 489.39
MDL number: MFCD00872139
EINECS: 267-745-3
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB766.40 | In Stock |
|
| 50mg | RMB1025.60 | In Stock |
|
| 100mg | RMB1483.20 | In Stock |
|
| 250mg | RMB2224.80 | In Stock |
|
| 1g | RMB5560.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173℃ |
| Boiling point: | 699.7±55.0 °C(Predicted) |
| Density | 1.39±0.1 g/cm3(Predicted) |
| solubility | Chloroform (Slightly), DMSO (Sparingly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 8.99±0.10(Predicted) |
| color | White to Off-White |
| InChIKey | LOUXSEJZCPKWAX-FACJPJGTNA-N |
| SMILES | N1(C2=CC=C(OC[C@H]3CO[C@@](C4=CC=C(Cl)C=C4Cl)(CN4C=NC=C4)O3)C=C2)CCNCC1 |&1:7,10,r| |
Description and Uses
Ketoconazole derivative.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
