BD0724445
4-(Methylsulfonyl)benzene-1-sulfonylchloride , 95% , 82964-91-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB100.00 | In Stock |
|
| 250mg | RMB132.80 | In Stock |
|
| 1g | RMB280.00 | In Stock |
|
| 5g | RMB1000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-169 °C(lit.) |
| Boiling point: | 158-163°C |
| Density | 1.4936 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | Yellow to salmon-pink |
| InChI | 1S/C7H7ClO4S2/c1-13(9,10)6-2-4-7(5-3-6)14(8,11)12/h2-5H,1H3 |
| InChIKey | TYJOQICPGZGYDT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(cc1)S(Cl)(=O)=O |
| CAS DataBase Reference | 82964-91-8(CAS DataBase Reference) |
Description and Uses
4-(Methylsulfonyl)benzenesulfonyl chloride may be used in the preparation of 5′-deoxy-5′-[4-(methylsulfonyl)benzenesulfonamido]thymidine.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 22-26-36/37/39-45-24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
