PRODUCT Properties
| Melting point: | 109-110 °C |
| Boiling point: | 396.7±31.0 °C(Predicted) |
| Density | 1.16±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in ethanol, methanol and water |
| form | powder to crystal |
| pka | 9.47±0.20(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2/t11-,12-,13-,15?/m1/s1 |
| InChIKey | ZSBXGIUJOOQZMP-OSBVZDBCSA-N |
| SMILES | N12CCC[C@@]3([H])C1[C@@]([H])([C@@]1([H])CCCC(=O)N1C3)CCC2 |
Description and Uses
Sophoridine is a quinolizidine alkaloid isolated from traditional Chinese herbs, which exists in the stems and leafs of Leguminous plant Sophora alopecuroides L., Euchresta japonica Benth., and the roots of Sophora alopecuroides Ait. Sophoridine-induced synchronous oscillations in the hippocampus could elicit the generation and development of seizure. Accumulating evidence demonstrates remarkable pharmacological effects of Sophoridine, including anti-inflammatory, anti-virus and anti-cancer effects.
(-)Sophoridine is an anticancer agent, with a promising anti-rumor effect and lower toxicity. Anti-inflammatory.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
| Safety Statements | 24/25 |
| HS Code | 29399990 |






