BD0732453
Rhodanine , 98% , 141-84-4
Synonym(s):
2-Thioxo-4-thiazolidinone
CAS NO.:141-84-4
Empirical Formula: C3H3NOS2
Molecular Weight: 133.19
MDL number: MFCD00005488
EINECS: 205-505-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB44.80 | In Stock |
|
| 25g | RMB145.60 | In Stock |
|
| 100g | RMB494.40 | In Stock |
|
| 500g | RMB2297.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-169 °C(lit.) |
| Density | 0.868 |
| refractive index | 1.5231 (estimate) |
| storage temp. | -20°C |
| solubility | methanol: soluble0.5g/10 mL, clear, colorless to greenish-yellow |
| form | Fine Crystalline Powder |
| pka | pK (25°) 5.52 |
| color | Light yellow to beige |
| Water Solubility | SOLUBLE IN HOT WATER |
| Merck | 14,8184 |
| BRN | 110701 |
| InChI | InChI=1S/C3H3NOS2/c5-2-1-7-3(6)4-2/h1H2,(H,4,5,6) |
| InChIKey | KIWUVOGUEXMXSV-UHFFFAOYSA-N |
| SMILES | S1CC(=O)NC1=S |
| CAS DataBase Reference | 141-84-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Thioxo-4-thiazolidinone(141-84-4) |
| EPA Substance Registry System | Rhodanine (141-84-4) |
Description and Uses
thiadiazole pharmaceutical intermediate
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 22-26-39 |
| RIDADR | 3288 |
| WGK Germany | 3 |
| RTECS | VI7700000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29341000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| Hazardous Substances Data | 141-84-4(Hazardous Substances Data) |





