BD0758545
Benzyl(3-bromopropyl)carbamate , 97% , 39945-54-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB144.80 | In Stock |
|
| 1g | RMB362.40 | In Stock |
|
| 5g | RMB1401.60 | In Stock |
|
| 10g | RMB2196.80 | In Stock |
|
| 25g | RMB4398.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-39 °C |
| Boiling point: | 379.4±35.0 °C(Predicted) |
| Density | 1.379±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 12.27±0.46(Predicted) |
| color | Off-White |
| InChI | InChI=1S/C11H14BrNO2/c12-7-4-8-13-11(14)15-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,13,14) |
| InChIKey | QGTWQXTXRILXOV-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)NCCCBr |
Description and Uses
N-tert-Butoxycarbonyl-3-bromopropylamine, is a versatile building block used in the synthesis of various pharmaceutical and biologically active compounds. It has been shown to be utilized in the synthesis of an active anti-HIV ethidium-arginine conjugate targeted against the viral TAR RNA sequence.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10-21 |
