BD0761732
3-Chloro-1,2-benzisoxazole , 97% , 16263-52-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB108.80 | In Stock |
|
| 1g | RMB244.00 | In Stock |
|
| 5g | RMB720.00 | In Stock |
|
| 10g | RMB1304.00 | In Stock |
|
| 25g | RMB3140.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31 °C |
| Boiling point: | 251.2±13.0 °C(Predicted) |
| Density | 1.377±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -5.47±0.30(Predicted) |
| Appearance | Light yellow to yellow <31°C Solid,>31°C Liquid |
| InChI | InChI=1S/C7H4ClNO/c8-7-5-3-1-2-4-6(5)10-9-7/h1-4H |
| InChIKey | INWUFXPCLZRSBH-UHFFFAOYSA-N |
| SMILES | O1C2=C(C=CC=C2)C(Cl)=N1 |
Description and Uses
3-Chloro-1,2-benzisoxazole can be used as reactant/reagent in preparation of piperazine and piperidine cyclohexyl derivatives and their application in treating psychoneurosis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| Hazard Note | Irritant |
| HS Code | 2934999090 |
