BD0767953
But-3-ene-1,2-diol , 98%+(stabilizedwithMEHQ) , 497-06-3
CAS NO.：497-06-3
Empirical Formula: C4H8O2
Molecular Weight: 88.11
MDL number: MFCD00239410
EINECS: 207-835-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB28.80 | In Stock |
|
| 25g | RMB113.60 | In Stock |
|
| 100g | RMB428.80 | In Stock |
|
| 500g | RMB1500.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 15.1°C (estimate) |
| Boiling point: | 195 °C/733 mmHg (lit.) |
| Density | 1.047 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 222 °F |
| storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 13.68±0.20(Predicted) |
| form | Oil |
| color | Clear Colorless |
| Specific Gravity | 1.047 |
| optical activity | 1.7875°(C=1g/100ml DCM) |
| BRN | 1633578 |
| InChI | InChI=1S/C4H8O2/c1-2-4(6)3-5/h2,4-6H,1,3H2 |
| InChIKey | ITMIAZBRRZANGB-UHFFFAOYSA-N |
| SMILES | C(O)C(O)C=C |
Description and Uses
3,4-Dihydroxy-1-butene can be used:
- As a reactant to synthesize cyclic organic carbonates by continuous flow procedure.
- To prepare substituted oxazolidinone ligands used to target medicinally relevant RNAs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| F | 10 |
