BD0783553
Methyl2-nitrobenzoate , 98% , 606-27-9
CAS NO.:606-27-9
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00007136
EINECS: 210-111-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB58.40 | In Stock |
|
| 25g | RMB205.60 | In Stock |
|
| 100g | RMB740.00 | In Stock |
|
| 500g | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -13 °C (lit.) |
| Boiling point: | 104-106 °C/0.1 mmHg (lit.) |
| Density | 1.28 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store at room temperature |
| form | Liquid |
| color | Clear yellow to orange-brownish |
| BRN | 2050101 |
| Dielectric constant | 28.0(25℃) |
| InChI | 1S/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
| InChIKey | AOXPHVNMBPFOFS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1[N+]([O-])=O |
| CAS DataBase Reference | 606-27-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-nitro-, methyl ester (606-27-9) |
Description and Uses
Methyl 2-nitrobenzoate may be used in chemical synthesis studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29163990 |
| Storage Class | 10 - Combustible liquids |







