BD0784553
Diethyltrichloromethylphosphonate , 97% , 866-23-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB74.40 | In Stock |
|
| 5g | RMB182.40 | In Stock |
|
| 25g | RMB630.40 | In Stock |
|
| 100g | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 130-131 °C/14 mmHg (lit.) |
| Density | 1.362 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Colorless to Almost colorless |
| Water Solubility | 4.5g/L(25 ºC) |
| BRN | 1210640 |
| InChI | InChI=1S/C5H10Cl3O3P/c1-3-10-12(9,11-4-2)5(6,7)8/h3-4H2,1-2H3 |
| InChIKey | RVAQSYWDOSHWGP-UHFFFAOYSA-N |
| SMILES | P(C(Cl)(Cl)Cl)(=O)(OCC)OCC |
Description and Uses
Diethyl (trichloromethyl)phosphonate may be used in the synthesis of chlorovinyl phosphonates via reaction with aldehydes and ketones.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-60-36/37 |
| RIDADR | UN3278 |
| WGK Germany | 3 |
| RTECS | TA0988000 |
| F | 9-21 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29319000 |
