BD0793432
(R)-BoroLeu-(+)-Pinanediol trifluoroacetate , 97% , 179324-87-9
CAS NO.:179324-87-9
Empirical Formula: C17H29BF3NO4
Molecular Weight: 379.23
MDL number: MFCD10566030
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB38.40 | In Stock |
|
| 1g | RMB97.60 | In Stock |
|
| 5g | RMB471.20 | In Stock |
|
| 10g | RMB898.40 | In Stock |
|
| 25g | RMB2033.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-159°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| optical activity | Consistent with structure |
| InChI | InChI=1/C15H28BNO2.C2HF3O2/c1-9(2)6-13(17)16-18-12-8-10-7-11(14(10,3)4)15(12,5)19-16;3-2(4,5)1(6)7/h9-13H,6-8,17H2,1-5H3;(H,6,7)/t10-,11-,12+,13-,15-;/s3 |
| InChIKey | SRFQKJZNJYTMNI-XXOUUVOINA-N |
| SMILES | C(F)(F)(F)C(=O)O.C[C@@]12OB([C@@H](N)CC(C)C)O[C@]1([H])C[C@]1([H])C[C@@]2([H])C1(C)C |&1:8,11,18,21,24,r| |
| CAS DataBase Reference | 179324-87-9(CAS DataBase Reference) |
Description and Uses
Bortezomib (B675700) intermediate. A boronic acid dipeptide derivative as proteasome inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 29209090 |







