BD1318148
((R)-3-Methyl-1-((R)-3-phenyl-2-(pyrazine-2-carboxamido)propanamido)butyl)boronicacid , 98+% , 1132709-15-9
CAS NO.：1132709-15-9
Empirical Formula: C19H25BN4O4
Molecular Weight: 384.24
MDL number: MFCD26940312
| Pack Size | Price | Stock | Quantity |
| 1g | RMB5818.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.214±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| pka | 9.66±0.43(Predicted) |
| color | White to Off-White |
| InChIKey | GXJABQQUPOEUTA-WBVHZDCISA-N |
| SMILES | B([C@@H](NC(=O)[C@H](NC(C1=NC=CN=C1)=O)CC1=CC=CC=C1)CC(C)C)(O)O |
Description and Uses
(1R,2R)-Bortezomib is a diastereomer of Bortezomib (B675700), the first proteasome inhibitor to be approved by the US FDA for multiple myeloma, a blood cancer. A reversible inhibitor of the 26S proteasome-a barrel-shaped multiprotein particle found in the nucleus and cytosol of all eukaryotic cells. Targets the ubiquitin-proteasome pathway
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
