BD0807032
1,3-Dioxo-1H-benzo[de]isoquinolin-2(3H)-yl trifluoromethanesulfonate , 97% , 85342-62-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB102.40 | In Stock |
|
| 5g | RMB416.80 | In Stock |
|
| 10g | RMB810.40 | In Stock |
|
| 25g | RMB1955.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 212.1-214.2 °C |
| Boiling point: | 456.2±55.0 °C(Predicted) |
| Density | 1.76±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | PGMEA: 1% |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C13H6F3NO5S/c14-13(15,16)23(20,21)22-17-11(18)8-5-1-3-7-4-2-6-9(10(7)8)12(17)19/h1-6H |
| InChIKey | LWHOMMCIJIJIGV-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(ON1C(=O)C2=CC=CC3=CC=CC(=C23)C1=O)(=O)=O |
| CAS DataBase Reference | 85342-62-7 |
Description and Uses
HNT can be used to form patterned nanoparticles that find potential applications in volumetric manufacturing of semiconductor devices. It can also be used in the photo-responsive pore reopening of zeolites that facilitates the regulation of the gas permeation process. UV-irradiated trimethylsilyl ultrathin cellulose based films can be formed in presence of HNT as a PAG.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |

![1,3-Dioxo-1H-benzo[de]isoquinolin-2(3H)-yl trifluoromethanesulfonate](https://img.chemicalbook.com/CAS/GIF/85342-62-7.gif)



