BD0855053
Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1,4-dicarboxylicacid,1-methylester , 98% , 24539-28-4
Synonym(s):
(1s,2R,3R,4s,5s,6S,7S,8r)-4-(Methoxycarbonyl)cubane-1-carboxylic acid;Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1,4-dicarboxylic acid, 1-methyl ester
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB434.40 | In Stock |
|
| 250mg | RMB840.00 | In Stock |
|
| 1g | RMB2364.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181°C |
| Boiling point: | 341.5±42.0 °C(Predicted) |
| Density | 1.956 |
| Flash point: | 141.4℃ |
| storage temp. | Store at room temperature |
| form | powder or crystals |
| pka | 4.24±0.40(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C11H10O4/c1-15-9(14)11-5-2-6(11)4-7(11)3(5)10(2,4)8(12)13/h2-7H,1H3,(H,12,13) |
| InChIKey | ARRJEFLYRAVFJA-UHFFFAOYSA-N |
| SMILES | C12(C(OC)=O)C3C4C5(C(O)=O)C3C1C5C42 |
Description and Uses
4-Methoxycarbonylcubanecarboxylic Acid is a cubane derivative being studied for its potential to act as a benzene bioisostere.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P302+P352-P280-P305+P351+P338-P261 |
| WGK Germany | WGK 3 |
| HS Code | 29172090 |
| Storage Class | 11 - Combustible Solids |

![Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1,4-dicarboxylicacid,1-methylester](https://img.chemicalbook.com/CAS/GIF/24539-28-4.gif)

![8-oxa-3-azabicyclo[3.2.1]octane hydrochloride](https://img.chemicalbook.com/CAS/GIF/54745-74-3.gif)

