BD0893253
3,3-Dimethyldihydro-2H-pyran-2,6(3H)-dione , 98% , 2938-48-9
CAS NO.：2938-48-9
Empirical Formula: C7H10O3
Molecular Weight: 142.15
MDL number: MFCD00006682
EINECS: 220-922-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB65.60 | In Stock |
|
| 1g | RMB161.60 | In Stock |
|
| 5g | RMB567.20 | In Stock |
|
| 25g | RMB2000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-38 °C (lit.) |
| Boiling point: | 175-180 °C/60 mmHg (lit.) |
| Density | 1.1643 (rough estimate) |
| refractive index | 1.4730 (estimate) |
| Flash point: | >230 °F |
| form | powder to lump |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| BRN | 117056 |
| InChI | InChI=1S/C7H10O3/c1-7(2)4-3-5(8)10-6(7)9/h3-4H2,1-2H3 |
| InChIKey | PAVNZLVXYJDFNR-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)CCC1(C)C |
| CAS DataBase Reference | 2938-48-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29171990 |
