BD0897932
1-Boc-3-Methanesulfonyloxyazetidine , 98% , 141699-58-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB40.00 | In Stock |
|
| 5g | RMB60.00 | In Stock |
|
| 10g | RMB106.40 | In Stock |
|
| 25g | RMB251.20 | In Stock |
|
| 100g | RMB984.00 | In Stock |
|
| 500g | RMB4312.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69 °C |
| Boiling point: | 378.5±31.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -4.18±0.40(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C9H17NO5S/c1-9(2,3)14-8(11)10-5-7(6-10)15-16(4,12)13/h7H,5-6H2,1-4H3 |
| InChIKey | XXBDTKYKFFIAEY-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC(OS(C)(=O)=O)C1 |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |





![Carbamicacid,[2-[(methylsulfonyl)oxy]ethyl]-,1,1-dimethylethylester](https://img.chemicalbook.com/CAS/GIF/96628-67-0.gif)