BD0912132
4-Iodobenzene-1,2-diamine , 97% , 21304-38-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB46.40 | In Stock |
|
| 250mg | RMB72.80 | In Stock |
|
| 1g | RMB201.60 | In Stock |
|
| 5g | RMB640.00 | In Stock |
|
| 10g | RMB1064.80 | In Stock |
|
| 25g | RMB2479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-77℃ |
| Boiling point: | 339.0±32.0 °C(Predicted) |
| Density | 2.016 |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| pka | 3.37±0.10(Predicted) |
| form | Solid |
| Appearance | Light brown to brown Solid |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C6H7IN2/c7-4-1-2-5(8)6(9)3-4/h1-3H,8-9H2 |
| InChIKey | FUOSRKZBOIVBOS-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(I)C=C1N |
| CAS DataBase Reference | 21304-38-1 |
Description and Uses
It is employed in the synthesis of N-(Benzimidazol-2-ylmethyl)iminodiacetic acids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| HazardClass | 6.1 |
| HS Code | 2921599090 |
